C30H26N6O3 — CID 66555296
4-[(1-benzyltriazol-4-yl)methylcarbamoylamino]-N-(4-phenoxyphenyl)benzamide (PubChem CID 66555296) has the molecular formula C30H26N6O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is 4-[(1-benzyltriazol-4-yl)methylcarbamoylamino]-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 4-[(1-benzyltriazol-4-yl)methylcarbamoylamino]-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 66555296 |
| Molecular Formula | C30H26N6O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 4-[(1-benzyltriazol-4-yl)methylcarbamoylamino]-N-(4-phenoxyphenyl)benzamide |
| SMILES | O=C(NCc1cn(Cc2ccccc2)nn1)Nc1ccc(C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H26N6O3/c37-29(32-24-15-17-28(18-16-24)39-27-9-5-2-6-10-27)23-11-13-25(14-12-23)33-30(38)31-19-26-21-36(35-34-26)20-22-7-3-1-4-8-22/h1-18,21H,19-20H2,(H,32,37)(H2,31,33,38) |
| InChIKey | XXKMTKIAGABWFX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |