C15H18O2 — CID 66557218
(4aR,11aR)-3,4a-dimethyl-2,5,6,7-tetrahydrobenzo[i]chromen-9-one (PubChem CID 66557218) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (4aR,11aR)-3,4a-dimethyl-2,5,6,7-tetrahydrobenzo[i]chromen-9-one.
| Compound Name | (4aR,11aR)-3,4a-dimethyl-2,5,6,7-tetrahydrobenzo[i]chromen-9-one |
|---|---|
| PubChem CID | 66557218 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (4aR,11aR)-3,4a-dimethyl-2,5,6,7-tetrahydrobenzo[i]chromen-9-one |
| SMILES | CC1=C[C@@]2(C)CCCC3=CC(=O)C=C[C@@]32OC1 |
| InChI | InChI=1S/C15H18O2/c1-11-9-14(2)6-3-4-12-8-13(16)5-7-15(12,14)17-10-11/h5,7-9H,3-4,6,10H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | FMCKCDREAIKGSO-HUUCEWRRSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|