C17H22N2O7S — CID 66557928
4-[5-(2,6-dimethoxyphenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 66557928) has the molecular formula C17H22N2O7S and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-[5-(2,6-dimethoxyphenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[5-(2,6-dimethoxyphenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 66557928 |
| Molecular Formula | C17H22N2O7S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[5-(2,6-dimethoxyphenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COc1cccc(OC)c1-c1cc(CCC(C)(C(=O)NO)S(C)(=O)=O)no1 |
| InChI | InChI=1S/C17H22N2O7S/c1-17(16(20)18-21,27(4,22)23)9-8-11-10-14(26-19-11)15-12(24-2)6-5-7-13(15)25-3/h5-7,10,21H,8-9H2,1-4H3,(H,18,20) |
| InChIKey | RCPSDMXTLOQNBB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|