C23H19ClF2N6O3S — CID 66558383
N-[2-chloro-5-[4-(oxan-4-ylamino)pyrido[3,2-d]pyrimidin-6-yl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide (PubChem CID 66558383) has the molecular formula C23H19ClF2N6O3S and a molecular weight of 532.96 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(oxan-4-ylamino)pyrido[3,2-d]pyrimidin-6-yl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[4-(oxan-4-ylamino)pyrido[3,2-d]pyrimidin-6-yl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 66558383 |
| Molecular Formula | C23H19ClF2N6O3S |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N-[2-chloro-5-[4-(oxan-4-ylamino)pyrido[3,2-d]pyrimidin-6-yl]-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3ncnc(NC4CCOCC4)c3n2)cnc1Cl)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H19ClF2N6O3S/c24-22-19(32-36(33,34)20-4-1-14(25)10-16(20)26)9-13(11-27-22)17-2-3-18-21(31-17)23(29-12-28-18)30-15-5-7-35-8-6-15/h1-4,9-12,15,32H,5-8H2,(H,28,29,30) |
| InChIKey | FGVFKGACELNWGS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|