C28H36N4O8 — CID 66558433
[5-(acetyloxymethoxy)-4,8-bis[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-1-yl]oxymethyl acetate (PubChem CID 66558433) has the molecular formula C28H36N4O8 and a molecular weight of 556.62 g/mol. Its IUPAC name is [5-(acetyloxymethoxy)-4,8-bis[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-1-yl]oxymethyl acetate.
| Compound Name | [5-(acetyloxymethoxy)-4,8-bis[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-1-yl]oxymethyl acetate |
|---|---|
| PubChem CID | 66558433 |
| Molecular Formula | C28H36N4O8 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | [5-(acetyloxymethoxy)-4,8-bis[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-1-yl]oxymethyl acetate |
| SMILES | CC(=O)OCOc1ccc(NCCN(C)C)c2c1C(=O)c1c(NCCN(C)C)ccc(OCOC(C)=O)c1C2=O |
| InChI | InChI=1S/C28H36N4O8/c1-17(33)37-15-39-21-9-7-19(29-11-13-31(3)4)23-25(21)27(35)24-20(30-12-14-32(5)6)8-10-22(26(24)28(23)36)40-16-38-18(2)34/h7-10,29-30H,11-16H2,1-6H3 |
| InChIKey | XCIKLUVWRPNHTA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|