C15H11NO6 — CID 66560332
[2-[(2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)carbamoyl]phenyl] acetate (PubChem CID 66560332) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is [2-[(2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 66560332 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [2-[(2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NC1=CC(=O)C2OC2C1=O |
| InChI | InChI=1S/C15H11NO6/c1-7(17)21-11-5-3-2-4-8(11)15(20)16-9-6-10(18)13-14(22-13)12(9)19/h2-6,13-14H,1H3,(H,16,20) |
| InChIKey | MEPMBPAJDZJQSC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|