C30H29NO10S — CID 66560959
[(E)-[(5aS,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-ylidene]amino] 4-ethylbenzenesulfonate (PubChem CID 66560959) has the molecular formula C30H29NO10S and a molecular weight of 595.63 g/mol. Its IUPAC name is [(E)-[(5aS,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-ylidene]amino] 4-ethylbenzenesulfonate.
| Compound Name | [(E)-[(5aS,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-ylidene]amino] 4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 66560959 |
| Molecular Formula | C30H29NO10S |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | [(E)-[(5aS,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-ylidene]amino] 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)O/N=C2/c3cc4c(cc3[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@@H]3C(=O)OC[C@H]23)OCO4)cc1 |
| InChI | InChI=1S/C30H29NO10S/c1-5-16-6-8-18(9-7-16)42(33,34)41-31-28-20-13-23-22(39-15-40-23)12-19(20)26(27-21(28)14-38-30(27)32)17-10-24(35-2)29(37-4)25(11-17)36-3/h6-13,21,26-27H,5,14-15H2,1-4H3/b31-28-/t21-,26+,27+/m0/s1 |
| InChIKey | MFMSPEOPXBYZTI-WNAXMLDTSA-N |
| XLogP | 4.05 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|