C20H36O5 — CID 66561944
[(3R,4R,6S)-3,4-dihydroxypentadec-1-en-6-yl] (3R)-3-hydroxypent-4-enoate (PubChem CID 66561944) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is [(3R,4R,6S)-3,4-dihydroxypentadec-1-en-6-yl] (3R)-3-hydroxypent-4-enoate.
| Compound Name | [(3R,4R,6S)-3,4-dihydroxypentadec-1-en-6-yl] (3R)-3-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 66561944 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | [(3R,4R,6S)-3,4-dihydroxypentadec-1-en-6-yl] (3R)-3-hydroxypent-4-enoate |
| SMILES | C=C[C@@H](O)[C@H](O)C[C@H](CCCCCCCCC)OC(=O)C[C@@H](O)C=C |
| InChI | InChI=1S/C20H36O5/c1-4-7-8-9-10-11-12-13-17(15-19(23)18(22)6-3)25-20(24)14-16(21)5-2/h5-6,16-19,21-23H,2-4,7-15H2,1H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | XFMJJTXZMIIPBJ-INDMIFKZSA-N |
| XLogP | 3.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|