C30H45ClN6O8S — CID 66563091
(2S)-2-[[2-butyl-5-chloro-3-[[4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]acetyl]sulfamoyl]phenyl]methyl]imidazol-4-yl]methylamino]-4-methylpentanoic acid (PubChem CID 66563091) has the molecular formula C30H45ClN6O8S and a molecular weight of 685.24 g/mol. Its IUPAC name is (2S)-2-[[2-butyl-5-chloro-3-[[4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]acetyl]sulfamoyl]phenyl]methyl]imidazol-4-yl]methylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-butyl-5-chloro-3-[[4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]acetyl]sulfamoyl]phenyl]methyl]imidazol-4-yl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66563091 |
| Molecular Formula | C30H45ClN6O8S |
| Molecular Weight | 685.24 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | (2S)-2-[[2-butyl-5-chloro-3-[[4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]acetyl]sulfamoyl]phenyl]methyl]imidazol-4-yl]methylamino]-4-methylpentanoic acid |
| SMILES | CCCCc1nc(Cl)c(CN[C@@H](CC(C)C)C(=O)O)n1Cc1ccc(S(=O)(=O)NC(=O)CNC(=O)C(CC(C)C)C(=O)NO)cc1 |
| InChI | InChI=1S/C30H45ClN6O8S/c1-6-7-8-25-34-27(31)24(15-32-23(30(41)42)14-19(4)5)37(25)17-20-9-11-21(12-10-20)46(44,45)36-26(38)16-33-28(39)22(13-18(2)3)29(40)35-43/h9-12,18-19,22-23,32,43H,6-8,13-17H2,1-5H3,(H,33,39)(H,35,40)(H,36,38)(H,41,42)/t22?,23-/m0/s1 |
| InChIKey | ULJNQOLCFRMBJN-WCSIJFPASA-N |
| XLogP | 2.61 |
| TPSA | 208.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|