C33H43ClN6O7S — CID 87246352
N-[2-[[4-[[2-butyl-4-chloro-5-(3-phenylpropylcarbamoyl)imidazol-1-yl]methyl]phenyl]sulfonylamino]-2-oxoethyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide (PubChem CID 87246352) has the molecular formula C33H43ClN6O7S and a molecular weight of 703.26 g/mol. Its IUPAC name is N-[2-[[4-[[2-butyl-4-chloro-5-(3-phenylpropylcarbamoyl)imidazol-1-yl]methyl]phenyl]sulfonylamino]-2-oxoethyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide.
| Compound Name | N-[2-[[4-[[2-butyl-4-chloro-5-(3-phenylpropylcarbamoyl)imidazol-1-yl]methyl]phenyl]sulfonylamino]-2-oxoethyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide |
|---|---|
| PubChem CID | 87246352 |
| Molecular Formula | C33H43ClN6O7S |
| Molecular Weight | 703.26 g/mol |
| Exact Mass | 702.26 |
| IUPAC Name | N-[2-[[4-[[2-butyl-4-chloro-5-(3-phenylpropylcarbamoyl)imidazol-1-yl]methyl]phenyl]sulfonylamino]-2-oxoethyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide |
| SMILES | CCCCc1nc(Cl)c(C(=O)NCCCc2ccccc2)n1Cc1ccc(S(=O)(=O)NC(=O)CNC(=O)C(CC(C)C)C(=O)NO)cc1 |
| InChI | InChI=1S/C33H43ClN6O7S/c1-4-5-13-27-37-30(34)29(33(44)35-18-9-12-23-10-7-6-8-11-23)40(27)21-24-14-16-25(17-15-24)48(46,47)39-28(41)20-36-31(42)26(19-22(2)3)32(43)38-45/h6-8,10-11,14-17,22,26,45H,4-5,9,12-13,18-21H2,1-3H3,(H,35,44)(H,36,42)(H,38,43)(H,39,41) |
| InChIKey | MPJIYZKWLCFVPG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 188.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|