C22H25N3O3S — CID 11640195
N-(4-butylphenyl)sulfonyl-2-(5-methyl-2-phenylpyrazol-3-yl)acetamide (PubChem CID 11640195) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-(4-butylphenyl)sulfonyl-2-(5-methyl-2-phenylpyrazol-3-yl)acetamide.
| Compound Name | N-(4-butylphenyl)sulfonyl-2-(5-methyl-2-phenylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 11640195 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-(4-butylphenyl)sulfonyl-2-(5-methyl-2-phenylpyrazol-3-yl)acetamide |
| SMILES | CCCCc1ccc(S(=O)(=O)NC(=O)Cc2cc(C)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-3-4-8-18-11-13-21(14-12-18)29(27,28)24-22(26)16-20-15-17(2)23-25(20)19-9-6-5-7-10-19/h5-7,9-15H,3-4,8,16H2,1-2H3,(H,24,26) |
| InChIKey | ZBKXEAXHYDVNEK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |