C28H29N3O4S — CID 67174220
[4-[5-[(4-butylphenyl)sulfonylamino]-1-(2-methylphenyl)pyrazol-3-yl]phenyl] acetate (PubChem CID 67174220) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is [4-[5-[(4-butylphenyl)sulfonylamino]-1-(2-methylphenyl)pyrazol-3-yl]phenyl] acetate.
| Compound Name | [4-[5-[(4-butylphenyl)sulfonylamino]-1-(2-methylphenyl)pyrazol-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67174220 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [4-[5-[(4-butylphenyl)sulfonylamino]-1-(2-methylphenyl)pyrazol-3-yl]phenyl] acetate |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(-c3ccc(OC(C)=O)cc3)nn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C28H29N3O4S/c1-4-5-9-22-11-17-25(18-12-22)36(33,34)30-28-19-26(23-13-15-24(16-14-23)35-21(3)32)29-31(28)27-10-7-6-8-20(27)2/h6-8,10-19,30H,4-5,9H2,1-3H3 |
| InChIKey | UQGQOLUDISBFAS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|