C25H28N4O2S2 — CID 67173092
4-butyl-N-[1-[4-(dimethylamino)phenyl]-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide (PubChem CID 67173092) has the molecular formula C25H28N4O2S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 4-butyl-N-[1-[4-(dimethylamino)phenyl]-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide.
| Compound Name | 4-butyl-N-[1-[4-(dimethylamino)phenyl]-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67173092 |
| Molecular Formula | C25H28N4O2S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-butyl-N-[1-[4-(dimethylamino)phenyl]-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(-c3cccs3)nn2-c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O2S2/c1-4-5-7-19-9-15-22(16-10-19)33(30,31)27-25-18-23(24-8-6-17-32-24)26-29(25)21-13-11-20(12-14-21)28(2)3/h6,8-18,27H,4-5,7H2,1-3H3 |
| InChIKey | HBYSSCKKVGEVAI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|