C25H31N3O2S — CID 110554365
1-(4-butylphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554365) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554365 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-(4-butylphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(c3cccs3)=C(N(C)C3CCN(C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H31N3O2S/c1-4-5-7-18-9-11-20(12-10-18)28-24(29)22(21-8-6-17-31-21)23(25(28)30)27(3)19-13-15-26(2)16-14-19/h6,8-12,17,19H,4-5,7,13-16H2,1-3H3 |
| InChIKey | RAWCERDQMKYLMP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|