C23H29N3O2S2 — CID 67174375
4-butyl-N-(1-cyclohexyl-3-thiophen-2-ylpyrazol-5-yl)benzenesulfonamide (PubChem CID 67174375) has the molecular formula C23H29N3O2S2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 4-butyl-N-(1-cyclohexyl-3-thiophen-2-ylpyrazol-5-yl)benzenesulfonamide.
| Compound Name | 4-butyl-N-(1-cyclohexyl-3-thiophen-2-ylpyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 67174375 |
| Molecular Formula | C23H29N3O2S2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-butyl-N-(1-cyclohexyl-3-thiophen-2-ylpyrazol-5-yl)benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(-c3cccs3)nn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O2S2/c1-2-3-8-18-12-14-20(15-13-18)30(27,28)25-23-17-21(22-11-7-16-29-22)24-26(23)19-9-5-4-6-10-19/h7,11-17,19,25H,2-6,8-10H2,1H3 |
| InChIKey | AHBMNHDKVLAGSE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |