C27H31N3O2S2 — CID 67173912
4-butyl-N-[1-(4-butylphenyl)-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide (PubChem CID 67173912) has the molecular formula C27H31N3O2S2 and a molecular weight of 493.70 g/mol. Its IUPAC name is 4-butyl-N-[1-(4-butylphenyl)-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide.
| Compound Name | 4-butyl-N-[1-(4-butylphenyl)-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67173912 |
| Molecular Formula | C27H31N3O2S2 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-butyl-N-[1-(4-butylphenyl)-3-thiophen-2-ylpyrazol-5-yl]benzenesulfonamide |
| SMILES | CCCCc1ccc(-n2nc(-c3cccs3)cc2NS(=O)(=O)c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C27H31N3O2S2/c1-3-5-8-21-11-15-23(16-12-21)30-27(20-25(28-30)26-10-7-19-33-26)29-34(31,32)24-17-13-22(14-18-24)9-6-4-2/h7,10-20,29H,3-6,8-9H2,1-2H3 |
| InChIKey | XPZQCYWHVXVVLU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |