C27H29N3O3S — CID 67174049
4-butyl-N-[3-(2-methoxyphenyl)-1-(2-methylphenyl)pyrazol-5-yl]benzenesulfonamide (PubChem CID 67174049) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 4-butyl-N-[3-(2-methoxyphenyl)-1-(2-methylphenyl)pyrazol-5-yl]benzenesulfonamide.
| Compound Name | 4-butyl-N-[3-(2-methoxyphenyl)-1-(2-methylphenyl)pyrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67174049 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-butyl-N-[3-(2-methoxyphenyl)-1-(2-methylphenyl)pyrazol-5-yl]benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(-c3ccccc3OC)nn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-4-5-11-21-15-17-22(18-16-21)34(31,32)29-27-19-24(23-12-7-9-14-26(23)33-3)28-30(27)25-13-8-6-10-20(25)2/h6-10,12-19,29H,4-5,11H2,1-3H3 |
| InChIKey | BXRNKWXUUXVQHT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |