C19H17N5O4S2 — CID 66572154
2-hydroxy-4-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzamide (PubChem CID 66572154) has the molecular formula C19H17N5O4S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 2-hydroxy-4-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzamide.
| Compound Name | 2-hydroxy-4-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzamide |
|---|---|
| PubChem CID | 66572154 |
| Molecular Formula | C19H17N5O4S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-hydroxy-4-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(Cc2nnc3n2N=C(c2ccc(C(N)=O)c(O)c2)CS3)cc1 |
| InChI | InChI=1S/C19H17N5O4S2/c1-30(27,28)13-5-2-11(3-6-13)8-17-21-22-19-24(17)23-15(10-29-19)12-4-7-14(18(20)26)16(25)9-12/h2-7,9,25H,8,10H2,1H3,(H2,20,26) |
| InChIKey | NQQSKOPBTKRJJB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |