C18H25N7O2 — CID 66584146
2-N-(3,5-dimethoxyphenyl)-8-N-[3-(dimethylamino)propyl]-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine (PubChem CID 66584146) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is 2-N-(3,5-dimethoxyphenyl)-8-N-[3-(dimethylamino)propyl]-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine.
| Compound Name | 2-N-(3,5-dimethoxyphenyl)-8-N-[3-(dimethylamino)propyl]-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine |
|---|---|
| PubChem CID | 66584146 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-N-(3,5-dimethoxyphenyl)-8-N-[3-(dimethylamino)propyl]-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine |
| SMILES | COc1cc(Nc2nc3c(NCCCN(C)C)nccn3n2)cc(OC)c1 |
| InChI | InChI=1S/C18H25N7O2/c1-24(2)8-5-6-19-16-17-22-18(23-25(17)9-7-20-16)21-13-10-14(26-3)12-15(11-13)27-4/h7,9-12H,5-6,8H2,1-4H3,(H,19,20)(H,21,23) |
| InChIKey | KSBLELTYAHIDIW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|