C17H23N7 — CID 66584174
8-N-[3-(dimethylamino)propyl]-2-N-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine (PubChem CID 66584174) has the molecular formula C17H23N7 and a molecular weight of 325.42 g/mol. Its IUPAC name is 8-N-[3-(dimethylamino)propyl]-2-N-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine.
| Compound Name | 8-N-[3-(dimethylamino)propyl]-2-N-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine |
|---|---|
| PubChem CID | 66584174 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 8-N-[3-(dimethylamino)propyl]-2-N-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrazine-2,8-diamine |
| SMILES | Cc1cccc(Nc2nc3c(NCCCN(C)C)nccn3n2)c1 |
| InChI | InChI=1S/C17H23N7/c1-13-6-4-7-14(12-13)20-17-21-16-15(18-8-5-10-23(2)3)19-9-11-24(16)22-17/h4,6-7,9,11-12H,5,8,10H2,1-3H3,(H,18,19)(H,20,22) |
| InChIKey | CFNMBSJBWACOMJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|