C27H24F3N3O3S — CID 66587653
(2-amino-5-piperidin-1-ylphenyl)-[1-(benzenesulfonyl)-6-(trifluoromethyl)indol-2-yl]methanone (PubChem CID 66587653) has the molecular formula C27H24F3N3O3S and a molecular weight of 527.57 g/mol. Its IUPAC name is (2-amino-5-piperidin-1-ylphenyl)-[1-(benzenesulfonyl)-6-(trifluoromethyl)indol-2-yl]methanone.
| Compound Name | (2-amino-5-piperidin-1-ylphenyl)-[1-(benzenesulfonyl)-6-(trifluoromethyl)indol-2-yl]methanone |
|---|---|
| PubChem CID | 66587653 |
| Molecular Formula | C27H24F3N3O3S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | (2-amino-5-piperidin-1-ylphenyl)-[1-(benzenesulfonyl)-6-(trifluoromethyl)indol-2-yl]methanone |
| SMILES | Nc1ccc(N2CCCCC2)cc1C(=O)c1cc2ccc(C(F)(F)F)cc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24F3N3O3S/c28-27(29,30)19-10-9-18-15-25(33(24(18)16-19)37(35,36)21-7-3-1-4-8-21)26(34)22-17-20(11-12-23(22)31)32-13-5-2-6-14-32/h1,3-4,7-12,15-17H,2,5-6,13-14,31H2 |
| InChIKey | JAAUIXLUNQMELC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|