C19H18ClFN2O2 — CID 66587790
methyl 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate (PubChem CID 66587790) has the molecular formula C19H18ClFN2O2 and a molecular weight of 360.82 g/mol. Its IUPAC name is methyl 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate.
| Compound Name | methyl 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 66587790 |
| Molecular Formula | C19H18ClFN2O2 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylate |
| SMILES | C=CC1(C)CC(c2ccc(F)c(Cl)c2)Nc2ccc(C(=O)OC)nc21 |
| InChI | InChI=1S/C19H18ClFN2O2/c1-4-19(2)10-16(11-5-6-13(21)12(20)9-11)22-14-7-8-15(18(24)25-3)23-17(14)19/h4-9,16,22H,1,10H2,2-3H3 |
| InChIKey | PJTSRVDOCCBCLS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|