C13H26N3+ — CID 66591286
1,3-dipropyl-2-pyrrolidin-1-ium-1-ylideneimidazolidine (PubChem CID 66591286) has the molecular formula C13H26N3+ and a molecular weight of 224.37 g/mol. Its IUPAC name is 1,3-dipropyl-2-pyrrolidin-1-ium-1-ylideneimidazolidine.
| Compound Name | 1,3-dipropyl-2-pyrrolidin-1-ium-1-ylideneimidazolidine |
|---|---|
| PubChem CID | 66591286 |
| Molecular Formula | C13H26N3+ |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 1,3-dipropyl-2-pyrrolidin-1-ium-1-ylideneimidazolidine |
| SMILES | CCCN1CCN(CCC)C1=[N+]1CCCC1 |
| InChI | InChI=1S/C13H26N3/c1-3-7-14-11-12-15(8-4-2)13(14)16-9-5-6-10-16/h3-12H2,1-2H3/q+1 |
| InChIKey | BVWFEAIASABSIF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|