C9H18Cl2N2 — CID 66592140
N,N-dicyclopropylazetidin-1-amine;dihydrochloride (PubChem CID 66592140) has the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. Its IUPAC name is N,N-dicyclopropylazetidin-1-amine;dihydrochloride.
| Compound Name | N,N-dicyclopropylazetidin-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 66592140 |
| Molecular Formula | C9H18Cl2N2 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N,N-dicyclopropylazetidin-1-amine;dihydrochloride |
| SMILES | C1CN(N(C2CC2)C2CC2)C1.Cl.Cl |
| InChI | InChI=1S/C9H16N2.2ClH/c1-6-10(7-1)11(8-2-3-8)9-4-5-9;;/h8-9H,1-7H2;2*1H |
| InChIKey | ICTFBOJTXWCXFL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |