C19H22F3NO7 — CID 66593987
2-[2-(diethylamino)-2-oxoethyl]-2-[2-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxoethyl]propanedioic acid (PubChem CID 66593987) has the molecular formula C19H22F3NO7 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-oxoethyl]-2-[2-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxoethyl]propanedioic acid.
| Compound Name | 2-[2-(diethylamino)-2-oxoethyl]-2-[2-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxoethyl]propanedioic acid |
|---|---|
| PubChem CID | 66593987 |
| Molecular Formula | C19H22F3NO7 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[2-(diethylamino)-2-oxoethyl]-2-[2-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxoethyl]propanedioic acid |
| SMILES | CCN(CC)C(=O)CC(CC(=O)c1ccc(OC)c(C(F)(F)F)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H22F3NO7/c1-4-23(5-2)15(25)10-18(16(26)27,17(28)29)9-13(24)11-6-7-14(30-3)12(8-11)19(20,21)22/h6-8H,4-5,9-10H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | FPDWBUOVTQJGIK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|