C22H30N6O2S — CID 66597169
5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfanylmethyl]-2-propoxyaniline (PubChem CID 66597169) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is 5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfanylmethyl]-2-propoxyaniline.
| Compound Name | 5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfanylmethyl]-2-propoxyaniline |
|---|---|
| PubChem CID | 66597169 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfanylmethyl]-2-propoxyaniline |
| SMILES | CCCOc1ccc(CSc2nc(N3CCOCC3)c3nc(CC)n(C)c3n2)cc1N |
| InChI | InChI=1S/C22H30N6O2S/c1-4-10-30-17-7-6-15(13-16(17)23)14-31-22-25-20-19(24-18(5-2)27(20)3)21(26-22)28-8-11-29-12-9-28/h6-7,13H,4-5,8-12,14,23H2,1-3H3 |
| InChIKey | WISAEMZMQAHDAQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|