C21H28N6O3S — CID 141283728
2-ethyl-5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfonylmethyl]aniline (PubChem CID 141283728) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-ethyl-5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfonylmethyl]aniline.
| Compound Name | 2-ethyl-5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfonylmethyl]aniline |
|---|---|
| PubChem CID | 141283728 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-ethyl-5-[(8-ethyl-9-methyl-6-morpholin-4-ylpurin-2-yl)sulfonylmethyl]aniline |
| SMILES | CCc1ccc(CS(=O)(=O)c2nc(N3CCOCC3)c3nc(CC)n(C)c3n2)cc1N |
| InChI | InChI=1S/C21H28N6O3S/c1-4-15-7-6-14(12-16(15)22)13-31(28,29)21-24-19-18(23-17(5-2)26(19)3)20(25-21)27-8-10-30-11-9-27/h6-7,12H,4-5,8-11,13,22H2,1-3H3 |
| InChIKey | HWXOUMWXWFZFFX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|