C31H30F2N2O6 — CID 66600443
ethyl 1-cyclopropyl-6,7-difluoro-4-oxo-8-[(4S)-7-oxo-4-(phenylmethoxycarbonylamino)oct-1-ynyl]quinoline-3-carboxylate (PubChem CID 66600443) has the molecular formula C31H30F2N2O6 and a molecular weight of 564.59 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-6,7-difluoro-4-oxo-8-[(4S)-7-oxo-4-(phenylmethoxycarbonylamino)oct-1-ynyl]quinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-6,7-difluoro-4-oxo-8-[(4S)-7-oxo-4-(phenylmethoxycarbonylamino)oct-1-ynyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 66600443 |
| Molecular Formula | C31H30F2N2O6 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | ethyl 1-cyclopropyl-6,7-difluoro-4-oxo-8-[(4S)-7-oxo-4-(phenylmethoxycarbonylamino)oct-1-ynyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(C#CC[C@H](CCC(C)=O)NC(=O)OCc3ccccc3)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C31H30F2N2O6/c1-3-40-30(38)25-17-35(22-14-15-22)28-23(27(33)26(32)16-24(28)29(25)37)11-7-10-21(13-12-19(2)36)34-31(39)41-18-20-8-5-4-6-9-20/h4-6,8-9,16-17,21-22H,3,10,12-15,18H2,1-2H3,(H,34,39)/t21-/m1/s1 |
| InChIKey | XQSJPNRCSRQUNT-OAQYLSRUSA-N |
| XLogP | 5.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|