C23H22N4O4 — CID 66604202
2-aminoethyl-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamic acid (PubChem CID 66604202) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-aminoethyl-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamic acid.
| Compound Name | 2-aminoethyl-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66604202 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-aminoethyl-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamic acid |
| SMILES | COc1cccc(-c2cc(C(N)=O)c3[nH]c4cc(N(CCN)C(=O)O)ccc4c3c2)c1 |
| InChI | InChI=1S/C23H22N4O4/c1-31-16-4-2-3-13(9-16)14-10-18-17-6-5-15(27(8-7-24)23(29)30)12-20(17)26-21(18)19(11-14)22(25)28/h2-6,9-12,26H,7-8,24H2,1H3,(H2,25,28)(H,29,30) |
| InChIKey | ADNFHXWSPLEGGJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |