C27H20FN3O5S — CID 66604859
6-N-(benzenesulfonyl)-3-(3-fluoro-4-methoxyphenyl)-9H-carbazole-1,6-dicarboxamide (PubChem CID 66604859) has the molecular formula C27H20FN3O5S and a molecular weight of 517.54 g/mol. Its IUPAC name is 6-N-(benzenesulfonyl)-3-(3-fluoro-4-methoxyphenyl)-9H-carbazole-1,6-dicarboxamide.
| Compound Name | 6-N-(benzenesulfonyl)-3-(3-fluoro-4-methoxyphenyl)-9H-carbazole-1,6-dicarboxamide |
|---|---|
| PubChem CID | 66604859 |
| Molecular Formula | C27H20FN3O5S |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 6-N-(benzenesulfonyl)-3-(3-fluoro-4-methoxyphenyl)-9H-carbazole-1,6-dicarboxamide |
| SMILES | COc1ccc(-c2cc(C(N)=O)c3[nH]c4ccc(C(=O)NS(=O)(=O)c5ccccc5)cc4c3c2)cc1F |
| InChI | InChI=1S/C27H20FN3O5S/c1-36-24-10-8-15(14-22(24)28)17-12-20-19-11-16(7-9-23(19)30-25(20)21(13-17)26(29)32)27(33)31-37(34,35)18-5-3-2-4-6-18/h2-14,30H,1H3,(H2,29,32)(H,31,33) |
| InChIKey | XXFCNNCJBSGWOG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |