C28H23N3O4 — CID 66605755
benzyl N-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamate (PubChem CID 66605755) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is benzyl N-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamate.
| Compound Name | benzyl N-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamate |
|---|---|
| PubChem CID | 66605755 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | benzyl N-[8-carbamoyl-6-(3-methoxyphenyl)-9H-carbazol-2-yl]carbamate |
| SMILES | COc1cccc(-c2cc(C(N)=O)c3[nH]c4cc(NC(=O)OCc5ccccc5)ccc4c3c2)c1 |
| InChI | InChI=1S/C28H23N3O4/c1-34-21-9-5-8-18(12-21)19-13-23-22-11-10-20(15-25(22)31-26(23)24(14-19)27(29)32)30-28(33)35-16-17-6-3-2-4-7-17/h2-15,31H,16H2,1H3,(H2,29,32)(H,30,33) |
| InChIKey | WKPHPYZQRMVDQR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |