C17H27N3O9 — CID 66609038
2-[1-(1-tert-butylpyrazol-3-yl)oxy-2-(diethylamino)ethoxy]-2-oxoacetic acid;oxalic acid (PubChem CID 66609038) has the molecular formula C17H27N3O9 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[1-(1-tert-butylpyrazol-3-yl)oxy-2-(diethylamino)ethoxy]-2-oxoacetic acid;oxalic acid.
| Compound Name | 2-[1-(1-tert-butylpyrazol-3-yl)oxy-2-(diethylamino)ethoxy]-2-oxoacetic acid;oxalic acid |
|---|---|
| PubChem CID | 66609038 |
| Molecular Formula | C17H27N3O9 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[1-(1-tert-butylpyrazol-3-yl)oxy-2-(diethylamino)ethoxy]-2-oxoacetic acid;oxalic acid |
| SMILES | CCN(CC)CC(OC(=O)C(=O)O)Oc1ccn(C(C)(C)C)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H25N3O5.C2H2O4/c1-6-17(7-2)10-12(23-14(21)13(19)20)22-11-8-9-18(16-11)15(3,4)5;3-1(4)2(5)6/h8-9,12H,6-7,10H2,1-5H3,(H,19,20);(H,3,4)(H,5,6) |
| InChIKey | JCPCZVISYOCWGB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|