C28H44N4O3 — CID 66613152
(3S,4S,5R)-4-ethyl-5-(hydroxymethyl)-2-[(3-piperazin-1-ylphenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide (PubChem CID 66613152) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is (3S,4S,5R)-4-ethyl-5-(hydroxymethyl)-2-[(3-piperazin-1-ylphenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3S,4S,5R)-4-ethyl-5-(hydroxymethyl)-2-[(3-piperazin-1-ylphenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 66613152 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | (3S,4S,5R)-4-ethyl-5-(hydroxymethyl)-2-[(3-piperazin-1-ylphenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
| SMILES | CC[C@@H]1[C@H](CO)ON(Cc2cccc(N3CCNCC3)c2)[C@@H]1C(=O)N[C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C |
| InChI | InChI=1S/C28H44N4O3/c1-5-22-25(17-33)35-32(16-19-7-6-8-21(13-19)31-11-9-29-10-12-31)26(22)27(34)30-24-15-20-14-23(18(24)2)28(20,3)4/h6-8,13,18,20,22-26,29,33H,5,9-12,14-17H2,1-4H3,(H,30,34)/t18-,20+,22+,23-,24-,25-,26-/m0/s1 |
| InChIKey | JDIDHGWNLXIGMT-UVZRXOOXSA-N |
| XLogP | 2.79 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |