C24H35IN2O4 — CID 163929420
(5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[(3-iodophenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide (PubChem CID 163929420) has the molecular formula C24H35IN2O4 and a molecular weight of 542.46 g/mol. Its IUPAC name is (5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[(3-iodophenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide.
| Compound Name | (5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[(3-iodophenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 163929420 |
| Molecular Formula | C24H35IN2O4 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | (5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[(3-iodophenyl)methyl]-N-[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
| SMILES | CC(O)C1C(C(=O)N[C@H]2C[C@H]3C[C@@H]([C@@H]2C)C3(C)C)N(Cc2cccc(I)c2)O[C@H]1CO |
| InChI | InChI=1S/C24H35IN2O4/c1-13-18-9-16(24(18,3)4)10-19(13)26-23(30)22-21(14(2)29)20(12-28)31-27(22)11-15-6-5-7-17(25)8-15/h5-8,13-14,16,18-22,28-29H,9-12H2,1-4H3,(H,26,30)/t13-,14?,16+,18-,19-,20-,21?,22?/m0/s1 |
| InChIKey | RHLDFGNZBKFXSF-MONZZWRPSA-N |
| XLogP | 2.95 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|