C24H35IN2O3 — CID 59346840
(2S,3R,4R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-1-[(3-iodophenyl)methyl]-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrrolidine-2-carboxamide (PubChem CID 59346840) has the molecular formula C24H35IN2O3 and a molecular weight of 526.46 g/mol. Its IUPAC name is (2S,3R,4R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-1-[(3-iodophenyl)methyl]-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-1-[(3-iodophenyl)methyl]-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59346840 |
| Molecular Formula | C24H35IN2O3 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (2S,3R,4R)-4-hydroxy-3-[(1S)-1-hydroxyethyl]-1-[(3-iodophenyl)methyl]-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](O)[C@H]1[C@@H](C(=O)NC2C[C@H]3C[C@@H]([C@@H]2C)C3(C)C)N(Cc2cccc(I)c2)C[C@@H]1O |
| InChI | InChI=1S/C24H35IN2O3/c1-13-18-9-16(24(18,3)4)10-19(13)26-23(30)22-21(14(2)28)20(29)12-27(22)11-15-6-5-7-17(25)8-15/h5-8,13-14,16,18-22,28-29H,9-12H2,1-4H3,(H,26,30)/t13-,14-,16+,18-,19?,20-,21+,22-/m0/s1 |
| InChIKey | KZMXMDZLNGHPLD-WVDFBOHQSA-N |
| XLogP | 3.02 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|