C17H19ClFN3O2 — CID 66622306
3-[(2-chloro-3-fluorophenyl)methyl]-1-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)-1-methylurea (PubChem CID 66622306) has the molecular formula C17H19ClFN3O2 and a molecular weight of 351.81 g/mol. Its IUPAC name is 3-[(2-chloro-3-fluorophenyl)methyl]-1-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)-1-methylurea.
| Compound Name | 3-[(2-chloro-3-fluorophenyl)methyl]-1-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)-1-methylurea |
|---|---|
| PubChem CID | 66622306 |
| Molecular Formula | C17H19ClFN3O2 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[(2-chloro-3-fluorophenyl)methyl]-1-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)-1-methylurea |
| SMILES | CN(C(=O)NCc1cccc(F)c1Cl)C(CO)Cc1ccccn1 |
| InChI | InChI=1S/C17H19ClFN3O2/c1-22(14(11-23)9-13-6-2-3-8-20-13)17(24)21-10-12-5-4-7-15(19)16(12)18/h2-8,14,23H,9-11H2,1H3,(H,21,24) |
| InChIKey | NTQCALCSNAKPIB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |