C14H17ClF3N5O2 — CID 76654978
1-(5-azido-4,4-difluoro-1-hydroxypentan-2-yl)-3-[(2-chloro-3-fluorophenyl)methyl]-1-methylurea (PubChem CID 76654978) has the molecular formula C14H17ClF3N5O2 and a molecular weight of 379.77 g/mol. Its IUPAC name is 1-(5-azido-4,4-difluoro-1-hydroxypentan-2-yl)-3-[(2-chloro-3-fluorophenyl)methyl]-1-methylurea.
| Compound Name | 1-(5-azido-4,4-difluoro-1-hydroxypentan-2-yl)-3-[(2-chloro-3-fluorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 76654978 |
| Molecular Formula | C14H17ClF3N5O2 |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(5-azido-4,4-difluoro-1-hydroxypentan-2-yl)-3-[(2-chloro-3-fluorophenyl)methyl]-1-methylurea |
| SMILES | CN(C(=O)NCc1cccc(F)c1Cl)C(CO)CC(F)(F)CN=[N+]=[N-] |
| InChI | InChI=1S/C14H17ClF3N5O2/c1-23(10(7-24)5-14(17,18)8-21-22-19)13(25)20-6-9-3-2-4-11(16)12(9)15/h2-4,10,24H,5-8H2,1H3,(H,20,25) |
| InChIKey | BMNZKACIUYGSPV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|