C16H26FN3O2 — CID 143764066
1-(5-amino-5-methylhexan-3-yl)-3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methylurea (PubChem CID 143764066) has the molecular formula C16H26FN3O2 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-(5-amino-5-methylhexan-3-yl)-3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methylurea.
| Compound Name | 1-(5-amino-5-methylhexan-3-yl)-3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 143764066 |
| Molecular Formula | C16H26FN3O2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(5-amino-5-methylhexan-3-yl)-3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methylurea |
| SMILES | CCC(CC(C)(C)N)N(C)C(=O)NCc1cccc(F)c1O |
| InChI | InChI=1S/C16H26FN3O2/c1-5-12(9-16(2,3)18)20(4)15(22)19-10-11-7-6-8-13(17)14(11)21/h6-8,12,21H,5,9-10,18H2,1-4H3,(H,19,22) |
| InChIKey | HAYABIRAGFTUKM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|