C16H23FN2O3 — CID 143763798
3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methyl-1-[(3S)-6-oxoheptan-3-yl]urea (PubChem CID 143763798) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methyl-1-[(3S)-6-oxoheptan-3-yl]urea.
| Compound Name | 3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methyl-1-[(3S)-6-oxoheptan-3-yl]urea |
|---|---|
| PubChem CID | 143763798 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-[(3-fluoro-2-hydroxyphenyl)methyl]-1-methyl-1-[(3S)-6-oxoheptan-3-yl]urea |
| SMILES | CC[C@@H](CCC(C)=O)N(C)C(=O)NCc1cccc(F)c1O |
| InChI | InChI=1S/C16H23FN2O3/c1-4-13(9-8-11(2)20)19(3)16(22)18-10-12-6-5-7-14(17)15(12)21/h5-7,13,21H,4,8-10H2,1-3H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | AXWHRCHTGXESTP-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|