C21H31FN6O3 — CID 143763894
N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide (PubChem CID 143763894) has the molecular formula C21H31FN6O3 and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide.
| Compound Name | N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide |
|---|---|
| PubChem CID | 143763894 |
| Molecular Formula | C21H31FN6O3 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide |
| SMILES | CC(=O)NCC(CCCN/C(=C/C#N)N(C)C)N(C)C(=O)NCc1cccc(F)c1O |
| InChI | InChI=1S/C21H31FN6O3/c1-15(29)25-14-17(8-6-12-24-19(10-11-23)27(2)3)28(4)21(31)26-13-16-7-5-9-18(22)20(16)30/h5,7,9-10,17,24,30H,6,8,12-14H2,1-4H3,(H,25,29)(H,26,31)/b19-10- |
| InChIKey | YAZRSNHDUPLGQK-GRSHGNNSSA-N |
| XLogP | 1.47 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|