C31H39F2N7O3 — CID 143763893
N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide;6-fluoro-3-methylisoquinoline (PubChem CID 143763893) has the molecular formula C31H39F2N7O3 and a molecular weight of 595.70 g/mol. Its IUPAC name is N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide;6-fluoro-3-methylisoquinoline.
| Compound Name | N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide;6-fluoro-3-methylisoquinoline |
|---|---|
| PubChem CID | 143763893 |
| Molecular Formula | C31H39F2N7O3 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | N-[5-[[(Z)-2-cyano-1-(dimethylamino)ethenyl]amino]-2-[(3-fluoro-2-hydroxyphenyl)methylcarbamoyl-methylamino]pentyl]acetamide;6-fluoro-3-methylisoquinoline |
| SMILES | CC(=O)NCC(CCCN/C(=C/C#N)N(C)C)N(C)C(=O)NCc1cccc(F)c1O.Cc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C21H31FN6O3.C10H8FN/c1-15(29)25-14-17(8-6-12-24-19(10-11-23)27(2)3)28(4)21(31)26-13-16-7-5-9-18(22)20(16)30;1-7-4-9-5-10(11)3-2-8(9)6-12-7/h5,7,9-10,17,24,30H,6,8,12-14H2,1-4H3,(H,25,29)(H,26,31);2-6H,1H3/b19-10-; |
| InChIKey | VVXPASBQFSWJAG-PEZBNFGJSA-N |
| XLogP | 4.16 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|