C30H33ClF2N6O3 — CID 143764184
[(2S)-8-amino-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-8-cyanoiminooctyl] 3-(6-fluoroisoquinolin-3-yl)propanoate (PubChem CID 143764184) has the molecular formula C30H33ClF2N6O3 and a molecular weight of 599.08 g/mol. Its IUPAC name is [(2S)-8-amino-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-8-cyanoiminooctyl] 3-(6-fluoroisoquinolin-3-yl)propanoate.
| Compound Name | [(2S)-8-amino-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-8-cyanoiminooctyl] 3-(6-fluoroisoquinolin-3-yl)propanoate |
|---|---|
| PubChem CID | 143764184 |
| Molecular Formula | C30H33ClF2N6O3 |
| Molecular Weight | 599.08 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | [(2S)-8-amino-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-8-cyanoiminooctyl] 3-(6-fluoroisoquinolin-3-yl)propanoate |
| SMILES | CN(C(=O)NCc1cccc(F)c1Cl)[C@@H](CCCCC/C(N)=N/C#N)COC(=O)CCc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C30H33ClF2N6O3/c1-39(30(41)37-17-21-6-5-8-26(33)29(21)31)25(7-3-2-4-9-27(35)38-19-34)18-42-28(40)13-12-24-15-22-14-23(32)11-10-20(22)16-36-24/h5-6,8,10-11,14-16,25H,2-4,7,9,12-13,17-18H2,1H3,(H2,35,38)(H,37,41)/t25-/m0/s1 |
| InChIKey | PCDKYOVKZSZJQE-VWLOTQADSA-N |
| XLogP | 5.64 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.08 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|