C22H37F2N2O6PS — CID 87431459
ditert-butyl [(4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-5-sulfanyloxypentyl] phosphate (PubChem CID 87431459) has the molecular formula C22H37F2N2O6PS and a molecular weight of 526.58 g/mol. Its IUPAC name is ditert-butyl [(4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-5-sulfanyloxypentyl] phosphate.
| Compound Name | ditert-butyl [(4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-5-sulfanyloxypentyl] phosphate |
|---|---|
| PubChem CID | 87431459 |
| Molecular Formula | C22H37F2N2O6PS |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | ditert-butyl [(4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-5-sulfanyloxypentyl] phosphate |
| SMILES | CN(C(=O)NCc1cccc(F)c1F)[C@@H](CCCOP(=O)(OC(C)(C)C)OC(C)(C)C)COS |
| InChI | InChI=1S/C22H37F2N2O6PS/c1-21(2,3)31-33(28,32-22(4,5)6)29-13-9-11-17(15-30-34)26(7)20(27)25-14-16-10-8-12-18(23)19(16)24/h8,10,12,17,34H,9,11,13-15H2,1-7H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | XITOPMRILRBTFX-KRWDZBQOSA-N |
| XLogP | 5.87 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|