C21H35F2NO3Si — CID 159319590
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-yl]-3-(2,3-difluorophenyl)-N-methylpropanamide (PubChem CID 159319590) has the molecular formula C21H35F2NO3Si and a molecular weight of 415.60 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-yl]-3-(2,3-difluorophenyl)-N-methylpropanamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-yl]-3-(2,3-difluorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 159319590 |
| Molecular Formula | C21H35F2NO3Si |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-yl]-3-(2,3-difluorophenyl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCc1cccc(F)c1F)[C@@H](CCCO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H35F2NO3Si/c1-21(2,3)28(5,6)27-15-17(10-8-14-25)24(4)19(26)13-12-16-9-7-11-18(22)20(16)23/h7,9,11,17,25H,8,10,12-15H2,1-6H3/t17-/m0/s1 |
| InChIKey | SDGMSLULOWODNO-KRWDZBQOSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|