C34H47F2N3O4 — CID 143763723
1,4-bis(prop-1-en-2-yl)benzene;[2-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-6-oxooctyl] formate;N-methylpropan-2-imine (PubChem CID 143763723) has the molecular formula C34H47F2N3O4 and a molecular weight of 599.76 g/mol. Its IUPAC name is 1,4-bis(prop-1-en-2-yl)benzene;[2-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-6-oxooctyl] formate;N-methylpropan-2-imine.
| Compound Name | 1,4-bis(prop-1-en-2-yl)benzene;[2-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-6-oxooctyl] formate;N-methylpropan-2-imine |
|---|---|
| PubChem CID | 143763723 |
| Molecular Formula | C34H47F2N3O4 |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | 1,4-bis(prop-1-en-2-yl)benzene;[2-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-6-oxooctyl] formate;N-methylpropan-2-imine |
| SMILES | C=C(C)c1ccc(C(=C)C)cc1.CCC(=O)CCCC(COC=O)N(C)C(=O)NCc1cccc(F)c1F.CN=C(C)C |
| InChI | InChI=1S/C18H24F2N2O4.C12H14.C4H9N/c1-3-15(24)8-5-7-14(11-26-12-23)22(2)18(25)21-10-13-6-4-9-16(19)17(13)20;1-9(2)11-5-7-12(8-6-11)10(3)4;1-4(2)5-3/h4,6,9,12,14H,3,5,7-8,10-11H2,1-2H3,(H,21,25);5-8H,1,3H2,2,4H3;1-3H3 |
| InChIKey | IZAAATSSIZLRAZ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|