C16H25ClFN2O5P — CID 123138922
[(4S)-4-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-2,2-dimethylpentyl] dihydrogen phosphate (PubChem CID 123138922) has the molecular formula C16H25ClFN2O5P and a molecular weight of 410.81 g/mol. Its IUPAC name is [(4S)-4-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-2,2-dimethylpentyl] dihydrogen phosphate.
| Compound Name | [(4S)-4-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-2,2-dimethylpentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 123138922 |
| Molecular Formula | C16H25ClFN2O5P |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(4S)-4-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-2,2-dimethylpentyl] dihydrogen phosphate |
| SMILES | C[C@@H](CC(C)(C)COP(=O)(O)O)N(C)C(=O)NCc1cccc(F)c1Cl |
| InChI | InChI=1S/C16H25ClFN2O5P/c1-11(8-16(2,3)10-25-26(22,23)24)20(4)15(21)19-9-12-6-5-7-13(18)14(12)17/h5-7,11H,8-10H2,1-4H3,(H,19,21)(H2,22,23,24)/t11-/m0/s1 |
| InChIKey | MALIJBNPZQHXMV-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|