C31H30Cl2N4O5 — CID 66624680
(2'R,3'R,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(2,5-dicarbamoylphenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylic acid (PubChem CID 66624680) has the molecular formula C31H30Cl2N4O5 and a molecular weight of 609.51 g/mol. Its IUPAC name is (2'R,3'R,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(2,5-dicarbamoylphenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylic acid.
| Compound Name | (2'R,3'R,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(2,5-dicarbamoylphenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylic acid |
|---|---|
| PubChem CID | 66624680 |
| Molecular Formula | C31H30Cl2N4O5 |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | (2'R,3'R,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(2,5-dicarbamoylphenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N(c2cc(C(N)=O)ccc2C(N)=O)[C@@H](C(=O)O)[C@H](c2cccc(Cl)c2)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H30Cl2N4O5/c1-30(2,3)14-23-31(20-10-8-18(33)13-21(20)36-29(31)42)24(15-5-4-6-17(32)11-15)25(28(40)41)37(23)22-12-16(26(34)38)7-9-19(22)27(35)39/h4-13,23-25H,14H2,1-3H3,(H2,34,38)(H2,35,39)(H,36,42)(H,40,41)/t23-,24-,25+,31?/m0/s1 |
| InChIKey | LZGWUWHSRMFCOV-UXMBLJCZSA-N |
| XLogP | 4.94 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |