About 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile
2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile (PubChem CID 66630267) has the molecular formula C20H26N4
and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile |
| PubChem CID | 66630267 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile |
| SMILES | CCCCCCC(CCCC)c1nc2cc(C#N)c(C#N)cc2[nH]1 |
| InChI | InChI=1S/C20H26N4/c1-3-5-7-8-10-15(9-6-4-2)20-23-18-11-16(13-21)17(14-22)12-19(18)24-20/h11-12,15H,3-10H2,1-2H3,(H,23,24) |
| InChIKey | VSCXIRQLFLWVRY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile?
The IUPAC name of 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile (CID 66630267) is 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile.
What is the SMILES notation for 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile?
The canonical SMILES for 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile is CCCCCCC(CCCC)c1nc2cc(C#N)c(C#N)cc2[nH]1.
What is the InChIKey of 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile?
The InChIKey is VSCXIRQLFLWVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4/c1-3-5-7-8-10-15(9-6-4-2)20-23-18-11-16(13-21)17(14-22)12-19(18)24-20/h11-12,15H,3-10H2,1-2H3,(H,23,24).
What are the key properties of 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile?
2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile has a molecular weight of 322.46 g/mol, XLogP of 5.55, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile is sourced from PubChem (CID 66630267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).