C20H26N4 — CID 66630267
2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile (PubChem CID 66630267) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile.
| Compound Name | 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 66630267 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2-undecan-5-yl-1H-benzimidazole-5,6-dicarbonitrile |
| SMILES | CCCCCCC(CCCC)c1nc2cc(C#N)c(C#N)cc2[nH]1 |
| InChI | InChI=1S/C20H26N4/c1-3-5-7-8-10-15(9-6-4-2)20-23-18-11-16(13-21)17(14-22)12-19(18)24-20/h11-12,15H,3-10H2,1-2H3,(H,23,24) |
| InChIKey | VSCXIRQLFLWVRY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|