About N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide
N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide (PubChem CID 66635253) has the molecular formula C20H20F2N4O
and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide |
| PubChem CID | 66635253 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)Cc1ccc(C#Cc2ccnc(N3CC(F)(F)C3)n2)cc1 |
| InChI | InChI=1S/C20H20F2N4O/c1-14(24-15(2)27)11-17-5-3-16(4-6-17)7-8-18-9-10-23-19(25-18)26-12-20(21,22)13-26/h3-6,9-10,14H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | KRKZQSCTLKABLF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide?
The IUPAC name of N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide (CID 66635253) is N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide.
What is the SMILES notation for N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide?
The canonical SMILES for N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide is CC(=O)NC(C)Cc1ccc(C#Cc2ccnc(N3CC(F)(F)C3)n2)cc1.
What is the InChIKey of N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide?
The InChIKey is KRKZQSCTLKABLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F2N4O/c1-14(24-15(2)27)11-17-5-3-16(4-6-17)7-8-18-9-10-23-19(25-18)26-12-20(21,22)13-26/h3-6,9-10,14H,11-13H2,1-2H3,(H,24,27).
What are the key properties of N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide?
N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide has a molecular weight of 370.40 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide is sourced from PubChem (CID 66635253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).