C20H20F2N4O — CID 66635253
N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide (PubChem CID 66635253) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide.
| Compound Name | N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 66635253 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-[1-[4-[2-[2-(3,3-difluoroazetidin-1-yl)pyrimidin-4-yl]ethynyl]phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)Cc1ccc(C#Cc2ccnc(N3CC(F)(F)C3)n2)cc1 |
| InChI | InChI=1S/C20H20F2N4O/c1-14(24-15(2)27)11-17-5-3-16(4-6-17)7-8-18-9-10-23-19(25-18)26-12-20(21,22)13-26/h3-6,9-10,14H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | KRKZQSCTLKABLF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|