C23H22N4O4 — CID 66639673
N-(14-methyl-17-nitro-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl)furan-3-carboxamide (PubChem CID 66639673) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-(14-methyl-17-nitro-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl)furan-3-carboxamide.
| Compound Name | N-(14-methyl-17-nitro-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 66639673 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-(14-methyl-17-nitro-2,14-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl)furan-3-carboxamide |
| SMILES | CN1c2ccccc2C2CC(NC(=O)c3ccoc3)CCN2c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H22N4O4/c1-25-19-5-3-2-4-18(19)21-12-16(24-23(28)15-9-11-31-14-15)8-10-26(21)20-7-6-17(27(29)30)13-22(20)25/h2-7,9,11,13-14,16,21H,8,10,12H2,1H3,(H,24,28) |
| InChIKey | HTZKSIOMXAZVJM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|